ChemNet > CAS > 465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile
465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile
| product Name |
3-[2-(3-chlorophenyl)acetyl]benzonitrile |
| CAS No |
465514-69-6 |
| Synonyms |
3-[(3-chlorophenyl)acetyl]benzonitrile |
| Molecular Formula |
C15H10ClNO |
| Molecular Weight |
255.699 |
| InChI |
InChI=1/C15H10ClNO/c16-14-6-2-3-11(8-14)9-15(18)13-5-1-4-12(7-13)10-17/h1-8H,9H2 |
| Molecular Structure |
![465514-69-6 3-[2-(3-chlorophenyl)acetyl]benzonitrile](https://images-a.chemnet.com/suppliers/chembase/849/116849.gif)
|
| Density |
1.27g/cm3 |
| Melting point |
87.5℃ |
| Boiling point |
416.5°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
205.7°C |
| Vapour Pressur |
3.81E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
